Name | azetidine-2-carboxylic acid |
Synonyms | DL-H-Aze-OH AZETIDINE-2-CARBO Azetidinecarboxylic Acid 2-Azetidinecarboxylic acid azetidine-2-carboxylic acid |
CAS | 2517-04-6 |
EINECS | 219-740-2 |
InChI | InChI=1/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7) |
Molecular Formula | C4H7NO2 |
Molar Mass | 101.1 |
Density | 1.276g/cm3 |
Melting Point | 217°C (rough estimate) |
Boling Point | 241.976°C at 760 mmHg |
Flash Point | 100.144°C |
Vapor Presure | 0.012mmHg at 25°C |
Storage Condition | Room Temprature |
Refractive Index | 1.499 |
Physical and Chemical Properties | Bioactive Azetidine-2-carboxylic acid is a non-proteogen amino acid homolog of proline. It can be found in common beets. In many species, including humans, it can be erroneously incorporated into proteins instead of proline. Toxic and teratogenic agents. |
melting point | 217°C (rough estimate) |
boiling point | 189.47°C (rough estimate) |
density | 1.2245 (rough estimate) |
refractive index | 1.4340 (estimate) |
storage conditions | Sealed in dry,Room Temperature |
acidity coefficient (pKa) | 2.35±0.20(Predicted) |
Azetidine-2-carboxylic acid (375-5oo μg per day) is incorporated into the collagen synthesized by chick embryo cartilage in vitro .